4-(4-methylphenyl)-8-[(phenylsulfanyl)acetyl]-1-thia-4,8-diazaspiro[4.5]decan-3-one
Chemical Structure Depiction of
4-(4-methylphenyl)-8-[(phenylsulfanyl)acetyl]-1-thia-4,8-diazaspiro[4.5]decan-3-one
4-(4-methylphenyl)-8-[(phenylsulfanyl)acetyl]-1-thia-4,8-diazaspiro[4.5]decan-3-one
Compound characteristics
| Compound ID: | V029-7365 |
| Compound Name: | 4-(4-methylphenyl)-8-[(phenylsulfanyl)acetyl]-1-thia-4,8-diazaspiro[4.5]decan-3-one |
| Molecular Weight: | 412.57 |
| Molecular Formula: | C22 H24 N2 O2 S2 |
| Smiles: | Cc1ccc(cc1)N1C(CSC12CCN(CC2)C(CSc1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4849 |
| logD: | 3.4849 |
| logSw: | -3.6312 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 32.04 |
| InChI Key: | QXBJJVVWWJOWKV-UHFFFAOYSA-N |