N-{2-[5-(2,5-dimethoxyphenyl)-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-[2-(morpholin-4-yl)ethyl]-N'-[4-(trifluoromethyl)phenyl]urea
Chemical Structure Depiction of
N-{2-[5-(2,5-dimethoxyphenyl)-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-[2-(morpholin-4-yl)ethyl]-N'-[4-(trifluoromethyl)phenyl]urea
N-{2-[5-(2,5-dimethoxyphenyl)-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-[2-(morpholin-4-yl)ethyl]-N'-[4-(trifluoromethyl)phenyl]urea
Compound characteristics
| Compound ID: | V029-7693 |
| Compound Name: | N-{2-[5-(2,5-dimethoxyphenyl)-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-[2-(morpholin-4-yl)ethyl]-N'-[4-(trifluoromethyl)phenyl]urea |
| Molecular Weight: | 645.7 |
| Molecular Formula: | C31 H34 F3 N5 O5 S |
| Salt: | not_available |
| Smiles: | COc1ccc(c(c1)C1CC(c2cccs2)=NN1C(CN(CCN1CCOCC1)C(Nc1ccc(cc1)C(F)(F)F)=O)=O)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0584 |
| logD: | 4.7019 |
| logSw: | -4.6963 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.681 |
| InChI Key: | YTIDIHLAPIZMCZ-AREMUKBSSA-N |