4-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-[(3-methylphenyl)methyl]benzamide
Chemical Structure Depiction of
4-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-[(3-methylphenyl)methyl]benzamide
4-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-[(3-methylphenyl)methyl]benzamide
Compound characteristics
| Compound ID: | V029-7736 |
| Compound Name: | 4-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-N-[(3-methylphenyl)methyl]benzamide |
| Molecular Weight: | 442.54 |
| Molecular Formula: | C26 H22 N2 O3 S |
| Smiles: | Cc1cccc(CNC(c2ccc(/C=C3/C(N(Cc4ccccc4)C(=O)S3)=O)cc2)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 5.4437 |
| logD: | 5.4437 |
| logSw: | -5.4128 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.009 |
| InChI Key: | MZQWVVUVBVNXIB-UHFFFAOYSA-N |