1-[3-(2-chlorophenyl)-5-(3-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-[4-(2-fluorophenyl)piperazin-1-yl]ethan-1-one
Chemical Structure Depiction of
1-[3-(2-chlorophenyl)-5-(3-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-[4-(2-fluorophenyl)piperazin-1-yl]ethan-1-one
1-[3-(2-chlorophenyl)-5-(3-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-[4-(2-fluorophenyl)piperazin-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | V030-0139 |
| Compound Name: | 1-[3-(2-chlorophenyl)-5-(3-fluorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-[4-(2-fluorophenyl)piperazin-1-yl]ethan-1-one |
| Molecular Weight: | 494.97 |
| Molecular Formula: | C27 H25 Cl F2 N4 O |
| Salt: | not_available |
| Smiles: | C1C(c2cccc(c2)F)N(C(CN2CCN(CC2)c2ccccc2F)=O)N=C1c1ccccc1[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3031 |
| logD: | 5.3023 |
| logSw: | -5.8331 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.551 |
| InChI Key: | VOXKCZFWFXGCKY-AREMUKBSSA-N |