N-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2-methylpropanamide
Chemical Structure Depiction of
N-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2-methylpropanamide
N-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2-methylpropanamide
Compound characteristics
| Compound ID: | V030-0537 |
| Compound Name: | N-[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2-methylpropanamide |
| Molecular Weight: | 314.77 |
| Molecular Formula: | C17 H15 Cl N2 O2 |
| Salt: | not_available |
| Smiles: | CC(C)C(Nc1cccc(c1)c1nc2cc(ccc2o1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.5576 |
| logD: | 4.5576 |
| logSw: | -4.6696 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.411 |
| InChI Key: | ABOZDSAZOLKXHP-UHFFFAOYSA-N |