2-(benzyloxy)-N-{2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-N-(2-methoxyethyl)acetamide
Chemical Structure Depiction of
2-(benzyloxy)-N-{2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-N-(2-methoxyethyl)acetamide
2-(benzyloxy)-N-{2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-N-(2-methoxyethyl)acetamide
Compound characteristics
| Compound ID: | V030-0886 |
| Compound Name: | 2-(benzyloxy)-N-{2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-N-(2-methoxyethyl)acetamide |
| Molecular Weight: | 429.9 |
| Molecular Formula: | C22 H24 Cl N3 O4 |
| Salt: | not_available |
| Smiles: | COCCN(CCc1nc(c2ccc(cc2)[Cl])no1)C(COCc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7534 |
| logD: | 3.7534 |
| logSw: | -4.4394 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 63.999 |
| InChI Key: | XDKAADWZPGRLRM-UHFFFAOYSA-N |