4-{[2-chloro-N-(2-methoxyethyl)benzamido]methyl}phenyl 4-methoxybenzene-1-sulfonate
Chemical Structure Depiction of
4-{[2-chloro-N-(2-methoxyethyl)benzamido]methyl}phenyl 4-methoxybenzene-1-sulfonate
4-{[2-chloro-N-(2-methoxyethyl)benzamido]methyl}phenyl 4-methoxybenzene-1-sulfonate
Compound characteristics
| Compound ID: | V030-1089 |
| Compound Name: | 4-{[2-chloro-N-(2-methoxyethyl)benzamido]methyl}phenyl 4-methoxybenzene-1-sulfonate |
| Molecular Weight: | 489.97 |
| Molecular Formula: | C24 H24 Cl N O6 S |
| Smiles: | COCCN(Cc1ccc(cc1)OS(c1ccc(cc1)OC)(=O)=O)C(c1ccccc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.9365 |
| logD: | 3.9365 |
| logSw: | -4.2853 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 68.076 |
| InChI Key: | WJJIRPMMOYQQPJ-UHFFFAOYSA-N |