N-{2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl}-N-[(furan-2-yl)methyl]-4-(trifluoromethyl)benzamide
Chemical Structure Depiction of
N-{2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl}-N-[(furan-2-yl)methyl]-4-(trifluoromethyl)benzamide
N-{2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl}-N-[(furan-2-yl)methyl]-4-(trifluoromethyl)benzamide
Compound characteristics
| Compound ID: | V030-1454 |
| Compound Name: | N-{2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl}-N-[(furan-2-yl)methyl]-4-(trifluoromethyl)benzamide |
| Molecular Weight: | 501.46 |
| Molecular Formula: | C25 H22 F3 N3 O5 |
| Salt: | not_available |
| Smiles: | COc1ccc(cc1OC)c1nc(CCN(Cc2ccco2)C(c2ccc(cc2)C(F)(F)F)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.848 |
| logD: | 4.848 |
| logSw: | -4.7477 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 70.509 |
| InChI Key: | ZXOWTPUXAGZMDH-UHFFFAOYSA-N |