N-benzyl-N-{2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-4-(trifluoromethyl)benzamide
Chemical Structure Depiction of
N-benzyl-N-{2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-4-(trifluoromethyl)benzamide
N-benzyl-N-{2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-4-(trifluoromethyl)benzamide
Compound characteristics
| Compound ID: | V030-1510 |
| Compound Name: | N-benzyl-N-{2-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-4-(trifluoromethyl)benzamide |
| Molecular Weight: | 496.44 |
| Molecular Formula: | C25 H19 F3 N4 O4 |
| Salt: | not_available |
| Smiles: | C(CN(Cc1ccccc1)C(c1ccc(cc1)C(F)(F)F)=O)c1nc(c2cccc(c2)[N+]([O-])=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 5.6392 |
| logD: | 5.6392 |
| logSw: | -6.0971 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 80.881 |
| InChI Key: | IEFTUHGNXZLJSO-UHFFFAOYSA-N |