6-(3-ethoxyphenyl)-3-{[4-(4-fluoro-2-methoxybenzene-1-sulfonyl)piperazin-1-yl]methyl}-2-(3-nitrophenyl)imidazo[1,2-a]pyridine
Chemical Structure Depiction of
6-(3-ethoxyphenyl)-3-{[4-(4-fluoro-2-methoxybenzene-1-sulfonyl)piperazin-1-yl]methyl}-2-(3-nitrophenyl)imidazo[1,2-a]pyridine
6-(3-ethoxyphenyl)-3-{[4-(4-fluoro-2-methoxybenzene-1-sulfonyl)piperazin-1-yl]methyl}-2-(3-nitrophenyl)imidazo[1,2-a]pyridine
Compound characteristics
| Compound ID: | V030-1615 |
| Compound Name: | 6-(3-ethoxyphenyl)-3-{[4-(4-fluoro-2-methoxybenzene-1-sulfonyl)piperazin-1-yl]methyl}-2-(3-nitrophenyl)imidazo[1,2-a]pyridine |
| Molecular Weight: | 645.71 |
| Molecular Formula: | C33 H32 F N5 O6 S |
| Salt: | not_available |
| Smiles: | CCOc1cccc(c1)c1ccc2nc(c3cccc(c3)[N+]([O-])=O)c(CN3CCN(CC3)S(c3ccc(cc3OC)F)(=O)=O)n2c1 |
| Stereo: | ACHIRAL |
| logP: | 5.9233 |
| logD: | 5.9228 |
| logSw: | -5.5303 |
| Hydrogen bond acceptors count: | 13 |
| Polar surface area: | 91.613 |
| InChI Key: | NLIJRTSGSBAREJ-UHFFFAOYSA-N |