1-tert-butyl-5-{4-(3,3-dimethylbutanamido)-2-[(2-methoxyethyl)sulfamoyl]phenoxy}-4-methyl-1H-pyrazole-3-carboxylic acid
Chemical Structure Depiction of
1-tert-butyl-5-{4-(3,3-dimethylbutanamido)-2-[(2-methoxyethyl)sulfamoyl]phenoxy}-4-methyl-1H-pyrazole-3-carboxylic acid
1-tert-butyl-5-{4-(3,3-dimethylbutanamido)-2-[(2-methoxyethyl)sulfamoyl]phenoxy}-4-methyl-1H-pyrazole-3-carboxylic acid
Compound characteristics
| Compound ID: | V030-1765 |
| Compound Name: | 1-tert-butyl-5-{4-(3,3-dimethylbutanamido)-2-[(2-methoxyethyl)sulfamoyl]phenoxy}-4-methyl-1H-pyrazole-3-carboxylic acid |
| Molecular Weight: | 524.64 |
| Molecular Formula: | C24 H36 N4 O7 S |
| Salt: | not_available |
| Smiles: | Cc1c(C(O)=O)nn(c1Oc1ccc(cc1S(NCCOC)(=O)=O)NC(CC(C)(C)C)=O)C(C)(C)C |
| Stereo: | ACHIRAL |
| logP: | 3.1795 |
| logD: | 0.4665 |
| logSw: | -3.5274 |
| Hydrogen bond acceptors count: | 13 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 123.938 |
| InChI Key: | MDAHTCRXAIYNTA-UHFFFAOYSA-N |