3-{[4-(2-chloro-5-nitrobenzene-1-sulfonyl)piperazin-1-yl]methyl}-2-(3-methoxyphenyl)-6-phenylimidazo[1,2-a]pyridine
Chemical Structure Depiction of
3-{[4-(2-chloro-5-nitrobenzene-1-sulfonyl)piperazin-1-yl]methyl}-2-(3-methoxyphenyl)-6-phenylimidazo[1,2-a]pyridine
3-{[4-(2-chloro-5-nitrobenzene-1-sulfonyl)piperazin-1-yl]methyl}-2-(3-methoxyphenyl)-6-phenylimidazo[1,2-a]pyridine
Compound characteristics
| Compound ID: | V030-2651 |
| Compound Name: | 3-{[4-(2-chloro-5-nitrobenzene-1-sulfonyl)piperazin-1-yl]methyl}-2-(3-methoxyphenyl)-6-phenylimidazo[1,2-a]pyridine |
| Molecular Weight: | 618.11 |
| Molecular Formula: | C31 H28 Cl N5 O5 S |
| Salt: | not_available |
| Smiles: | COc1cccc(c1)c1c(CN2CCN(CC2)S(c2cc(ccc2[Cl])[N+]([O-])=O)(=O)=O)n2cc(ccc2n1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.8599 |
| logD: | 5.6565 |
| logSw: | -6.0852 |
| Hydrogen bond acceptors count: | 12 |
| Polar surface area: | 84.403 |
| InChI Key: | HVDCVZOPDNZQGA-UHFFFAOYSA-N |