3-{[4-(4-fluoro-2-methoxybenzene-1-sulfonyl)piperazin-1-yl]methyl}-2-(4-nitrophenyl)-6-phenylimidazo[1,2-a]pyridine
Chemical Structure Depiction of
3-{[4-(4-fluoro-2-methoxybenzene-1-sulfonyl)piperazin-1-yl]methyl}-2-(4-nitrophenyl)-6-phenylimidazo[1,2-a]pyridine
3-{[4-(4-fluoro-2-methoxybenzene-1-sulfonyl)piperazin-1-yl]methyl}-2-(4-nitrophenyl)-6-phenylimidazo[1,2-a]pyridine
Compound characteristics
| Compound ID: | V030-2686 |
| Compound Name: | 3-{[4-(4-fluoro-2-methoxybenzene-1-sulfonyl)piperazin-1-yl]methyl}-2-(4-nitrophenyl)-6-phenylimidazo[1,2-a]pyridine |
| Molecular Weight: | 601.66 |
| Molecular Formula: | C31 H28 F N5 O5 S |
| Salt: | not_available |
| Smiles: | COc1cc(ccc1S(N1CCN(CC1)Cc1c(c2ccc(cc2)[N+]([O-])=O)nc2ccc(cn12)c1ccccc1)(=O)=O)F |
| Stereo: | ACHIRAL |
| logP: | 5.3191 |
| logD: | 5.3115 |
| logSw: | -5.3754 |
| Hydrogen bond acceptors count: | 12 |
| Polar surface area: | 84.49 |
| InChI Key: | GKEUIDRZVTWIPL-UHFFFAOYSA-N |