2-fluoro-N-({2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-(2-methylpropyl)benzamide
Chemical Structure Depiction of
2-fluoro-N-({2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-(2-methylpropyl)benzamide
2-fluoro-N-({2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-(2-methylpropyl)benzamide
Compound characteristics
| Compound ID: | V030-2759 |
| Compound Name: | 2-fluoro-N-({2-[(3-methylphenoxy)methyl]-1,3-thiazol-4-yl}methyl)-N-(2-methylpropyl)benzamide |
| Molecular Weight: | 412.53 |
| Molecular Formula: | C23 H25 F N2 O2 S |
| Salt: | not_available |
| Smiles: | CC(C)CN(Cc1csc(COc2cccc(C)c2)n1)C(c1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5521 |
| logD: | 5.5521 |
| logSw: | -5.4722 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 34.673 |
| InChI Key: | RSRUZVKHBAHEMX-UHFFFAOYSA-N |