6-[4-(3,4-dichlorophenyl)piperazin-1-yl]-4-(2-fluorophenyl)-2-(3-fluorophenyl)-2H-pyrazolo[3,4-d]pyrimidin-3-amine
Chemical Structure Depiction of
6-[4-(3,4-dichlorophenyl)piperazin-1-yl]-4-(2-fluorophenyl)-2-(3-fluorophenyl)-2H-pyrazolo[3,4-d]pyrimidin-3-amine
6-[4-(3,4-dichlorophenyl)piperazin-1-yl]-4-(2-fluorophenyl)-2-(3-fluorophenyl)-2H-pyrazolo[3,4-d]pyrimidin-3-amine
Compound characteristics
| Compound ID: | V030-2965 |
| Compound Name: | 6-[4-(3,4-dichlorophenyl)piperazin-1-yl]-4-(2-fluorophenyl)-2-(3-fluorophenyl)-2H-pyrazolo[3,4-d]pyrimidin-3-amine |
| Molecular Weight: | 552.41 |
| Molecular Formula: | C27 H21 Cl2 F2 N7 |
| Salt: | not_available |
| Smiles: | C1CN(CCN1c1ccc(c(c1)[Cl])[Cl])c1nc(c2ccccc2F)c2c(n1)nn(c1cccc(c1)F)c2N |
| Stereo: | ACHIRAL |
| logP: | 6.8368 |
| logD: | 6.8368 |
| logSw: | -7.1294 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.082 |
| InChI Key: | YRKJXRWCTPZBPQ-UHFFFAOYSA-N |