2-{[N-(cyclopropylmethyl)(ethyl)carbamamido]methyl}phenyl ethanesulfonate
Chemical Structure Depiction of
2-{[N-(cyclopropylmethyl)(ethyl)carbamamido]methyl}phenyl ethanesulfonate
2-{[N-(cyclopropylmethyl)(ethyl)carbamamido]methyl}phenyl ethanesulfonate
Compound characteristics
| Compound ID: | V030-3281 |
| Compound Name: | 2-{[N-(cyclopropylmethyl)(ethyl)carbamamido]methyl}phenyl ethanesulfonate |
| Molecular Weight: | 340.44 |
| Molecular Formula: | C16 H24 N2 O4 S |
| Smiles: | CCNC(N(CC1CC1)Cc1ccccc1OS(CC)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5506 |
| logD: | 2.5506 |
| logSw: | -2.8081 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.937 |
| InChI Key: | RATXGFCYKUWCOC-UHFFFAOYSA-N |