N-{2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-2-(4-fluorophenyl)-N-(2-phenylethyl)acetamide
Chemical Structure Depiction of
N-{2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-2-(4-fluorophenyl)-N-(2-phenylethyl)acetamide
N-{2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-2-(4-fluorophenyl)-N-(2-phenylethyl)acetamide
Compound characteristics
| Compound ID: | V030-3826 |
| Compound Name: | N-{2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-2-(4-fluorophenyl)-N-(2-phenylethyl)acetamide |
| Molecular Weight: | 463.94 |
| Molecular Formula: | C26 H23 Cl F N3 O2 |
| Salt: | not_available |
| Smiles: | C(CN(CCc1nc(c2ccc(cc2)[Cl])no1)C(Cc1ccc(cc1)F)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.9421 |
| logD: | 5.9421 |
| logSw: | -6.2677 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.95 |
| InChI Key: | HESJGGXLHFSOHY-UHFFFAOYSA-N |