3-bromo-N-cyclohexyl-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)benzamide
Chemical Structure Depiction of
3-bromo-N-cyclohexyl-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)benzamide
3-bromo-N-cyclohexyl-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)benzamide
Compound characteristics
| Compound ID: | V030-4379 |
| Compound Name: | 3-bromo-N-cyclohexyl-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)benzamide |
| Molecular Weight: | 537.5 |
| Molecular Formula: | C29 H33 Br N2 O3 |
| Smiles: | Cc1ccc(CN(CCc2ccccc2)C(CN(C2CCCCC2)C(c2cccc(c2)[Br])=O)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 6.3767 |
| logD: | 6.3767 |
| logSw: | -5.4863 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 38.347 |
| InChI Key: | IFAXENYZNMEOOJ-UHFFFAOYSA-N |