2-(benzyloxy)-N-{1-[3-(3-chloro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]-2-methylbutyl}acetamide
Chemical Structure Depiction of
2-(benzyloxy)-N-{1-[3-(3-chloro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]-2-methylbutyl}acetamide
2-(benzyloxy)-N-{1-[3-(3-chloro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]-2-methylbutyl}acetamide
Compound characteristics
| Compound ID: | V030-4690 |
| Compound Name: | 2-(benzyloxy)-N-{1-[3-(3-chloro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]-2-methylbutyl}acetamide |
| Molecular Weight: | 427.93 |
| Molecular Formula: | C23 H26 Cl N3 O3 |
| Salt: | not_available |
| Smiles: | CCC(C)C(c1nc(c2ccc(C)c(c2)[Cl])no1)NC(COCc1ccccc1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 6.0676 |
| logD: | 6.0676 |
| logSw: | -6.1114 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.902 |
| InChI Key: | SBVSLHDLYJTQAZ-UHFFFAOYSA-N |