2-(benzyloxy)-1-{4-[6-(4-methoxyphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl}ethan-1-one
Chemical Structure Depiction of
2-(benzyloxy)-1-{4-[6-(4-methoxyphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl}ethan-1-one
2-(benzyloxy)-1-{4-[6-(4-methoxyphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl}ethan-1-one
Compound characteristics
| Compound ID: | V030-4920 |
| Compound Name: | 2-(benzyloxy)-1-{4-[6-(4-methoxyphenoxy)pyrimidin-4-yl]-2-methylpiperazin-1-yl}ethan-1-one |
| Molecular Weight: | 448.52 |
| Molecular Formula: | C25 H28 N4 O4 |
| Salt: | not_available |
| Smiles: | CC1CN(CCN1C(COCc1ccccc1)=O)c1cc(ncn1)Oc1ccc(cc1)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6712 |
| logD: | 3.6712 |
| logSw: | -4.0502 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 60.738 |
| InChI Key: | ZSKGCXOIWDQLEM-IBGZPJMESA-N |