4-(cyclopropylmethyl)-N-[(furan-2-yl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide
Chemical Structure Depiction of
4-(cyclopropylmethyl)-N-[(furan-2-yl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide
4-(cyclopropylmethyl)-N-[(furan-2-yl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide
Compound characteristics
| Compound ID: | V030-5222 |
| Compound Name: | 4-(cyclopropylmethyl)-N-[(furan-2-yl)methyl]-4H-thieno[3,2-b]pyrrole-5-carboxamide |
| Molecular Weight: | 300.38 |
| Molecular Formula: | C16 H16 N2 O2 S |
| Salt: | not_available |
| Smiles: | C1CC1Cn1c(cc2c1ccs2)C(NCc1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8191 |
| logD: | 3.819 |
| logSw: | -4.0667 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.396 |
| InChI Key: | OXYQHGHRFNWNJO-UHFFFAOYSA-N |