ethyl 1-[2-({[(2,4-dimethoxyphenyl)methyl](3,3-diphenylpropyl)amino}methyl)-1,3-thiazole-4-carbonyl]piperidine-4-carboxylate
Chemical Structure Depiction of
ethyl 1-[2-({[(2,4-dimethoxyphenyl)methyl](3,3-diphenylpropyl)amino}methyl)-1,3-thiazole-4-carbonyl]piperidine-4-carboxylate
ethyl 1-[2-({[(2,4-dimethoxyphenyl)methyl](3,3-diphenylpropyl)amino}methyl)-1,3-thiazole-4-carbonyl]piperidine-4-carboxylate
Compound characteristics
| Compound ID: | V030-5875 |
| Compound Name: | ethyl 1-[2-({[(2,4-dimethoxyphenyl)methyl](3,3-diphenylpropyl)amino}methyl)-1,3-thiazole-4-carbonyl]piperidine-4-carboxylate |
| Molecular Weight: | 641.83 |
| Molecular Formula: | C37 H43 N3 O5 S |
| Salt: | not_available |
| Smiles: | CCOC(C1CCN(CC1)C(c1csc(CN(CCC(c2ccccc2)c2ccccc2)Cc2ccc(cc2OC)OC)n1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.6353 |
| logD: | 6.6353 |
| logSw: | -5.5898 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 66.462 |
| InChI Key: | XTEXQMGPELMEMK-UHFFFAOYSA-N |