{4-[6-(cyclohexylmethyl)-1-(4-fluorophenyl)-3-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}(thiophen-2-yl)methanone
Chemical Structure Depiction of
{4-[6-(cyclohexylmethyl)-1-(4-fluorophenyl)-3-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}(thiophen-2-yl)methanone
{4-[6-(cyclohexylmethyl)-1-(4-fluorophenyl)-3-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}(thiophen-2-yl)methanone
Compound characteristics
| Compound ID: | V030-6008 |
| Compound Name: | {4-[6-(cyclohexylmethyl)-1-(4-fluorophenyl)-3-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl]piperazin-1-yl}(thiophen-2-yl)methanone |
| Molecular Weight: | 518.66 |
| Molecular Formula: | C28 H31 F N6 O S |
| Salt: | not_available |
| Smiles: | Cc1c2c(nc(CC3CCCCC3)nc2n(c2ccc(cc2)F)n1)N1CCN(CC1)C(c1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.1926 |
| logD: | 5.5022 |
| logSw: | -5.7149 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 55.361 |
| InChI Key: | YWCSDUGCDSNYGI-UHFFFAOYSA-N |