{4-[4-(4-phenoxyphenyl)pyrimidin-2-yl]piperazin-1-yl}[2-(trifluoromethoxy)phenyl]methanone
Chemical Structure Depiction of
{4-[4-(4-phenoxyphenyl)pyrimidin-2-yl]piperazin-1-yl}[2-(trifluoromethoxy)phenyl]methanone
{4-[4-(4-phenoxyphenyl)pyrimidin-2-yl]piperazin-1-yl}[2-(trifluoromethoxy)phenyl]methanone
Compound characteristics
| Compound ID: | V030-6020 |
| Compound Name: | {4-[4-(4-phenoxyphenyl)pyrimidin-2-yl]piperazin-1-yl}[2-(trifluoromethoxy)phenyl]methanone |
| Molecular Weight: | 520.51 |
| Molecular Formula: | C28 H23 F3 N4 O3 |
| Salt: | not_available |
| Smiles: | C1CN(CCN1C(c1ccccc1OC(F)(F)F)=O)c1nccc(c2ccc(cc2)Oc2ccccc2)n1 |
| Stereo: | ACHIRAL |
| logP: | 6.6748 |
| logD: | 6.6748 |
| logSw: | -6.0802 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 50.577 |
| InChI Key: | SESQTWVUWXZQIC-UHFFFAOYSA-N |