N'-tert-butyl-N-(2-methoxyethyl)-N-{[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl}urea
Chemical Structure Depiction of
N'-tert-butyl-N-(2-methoxyethyl)-N-{[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl}urea
N'-tert-butyl-N-(2-methoxyethyl)-N-{[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl}urea
Compound characteristics
| Compound ID: | V030-6470 |
| Compound Name: | N'-tert-butyl-N-(2-methoxyethyl)-N-{[2-(phenoxymethyl)-1,3-thiazol-4-yl]methyl}urea |
| Molecular Weight: | 377.5 |
| Molecular Formula: | C19 H27 N3 O3 S |
| Salt: | not_available |
| Smiles: | CC(C)(C)NC(N(CCOC)Cc1csc(COc2ccccc2)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6247 |
| logD: | 3.6245 |
| logSw: | -3.6462 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.232 |
| InChI Key: | ZEQOYNFWTCAWNG-UHFFFAOYSA-N |