N-[2-(3,5-dimethylphenyl)imidazo[1,2-a]pyridin-3-yl]-3-fluorobenzamide
Chemical Structure Depiction of
N-[2-(3,5-dimethylphenyl)imidazo[1,2-a]pyridin-3-yl]-3-fluorobenzamide
N-[2-(3,5-dimethylphenyl)imidazo[1,2-a]pyridin-3-yl]-3-fluorobenzamide
Compound characteristics
| Compound ID: | V030-6480 |
| Compound Name: | N-[2-(3,5-dimethylphenyl)imidazo[1,2-a]pyridin-3-yl]-3-fluorobenzamide |
| Molecular Weight: | 359.4 |
| Molecular Formula: | C22 H18 F N3 O |
| Salt: | not_available |
| Smiles: | Cc1cc(C)cc(c1)c1c(NC(c2cccc(c2)F)=O)n2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 4.6671 |
| logD: | 4.667 |
| logSw: | -4.4404 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.858 |
| InChI Key: | CVLBFIUTBIRDJS-UHFFFAOYSA-N |