3-[6-(1-benzothiophen-2-yl)-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]-1-(morpholin-4-yl)propan-1-one
Chemical Structure Depiction of
3-[6-(1-benzothiophen-2-yl)-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]-1-(morpholin-4-yl)propan-1-one
3-[6-(1-benzothiophen-2-yl)-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]-1-(morpholin-4-yl)propan-1-one
Compound characteristics
| Compound ID: | V030-6559 |
| Compound Name: | 3-[6-(1-benzothiophen-2-yl)-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]-1-(morpholin-4-yl)propan-1-one |
| Molecular Weight: | 481.62 |
| Molecular Formula: | C29 H27 N3 O2 S |
| Salt: | not_available |
| Smiles: | Cc1ccc(cc1)c1c(CCC(N2CCOCC2)=O)n2cc(ccc2n1)c1cc2ccccc2s1 |
| Stereo: | ACHIRAL |
| logP: | 5.6308 |
| logD: | 5.615 |
| logSw: | -6.1447 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.003 |
| InChI Key: | TUSOUXDYDWLZFP-UHFFFAOYSA-N |