2-(benzyloxy)-N-{2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl}acetamide
Chemical Structure Depiction of
2-(benzyloxy)-N-{2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl}acetamide
2-(benzyloxy)-N-{2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl}acetamide
Compound characteristics
| Compound ID: | V030-6677 |
| Compound Name: | 2-(benzyloxy)-N-{2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl}acetamide |
| Molecular Weight: | 397.43 |
| Molecular Formula: | C21 H23 N3 O5 |
| Salt: | not_available |
| Smiles: | COc1ccc(cc1OC)c1nc(CCNC(COCc2ccccc2)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 2.4967 |
| logD: | 2.4967 |
| logSw: | -2.9488 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.318 |
| InChI Key: | PWVRPZOZWINCTA-UHFFFAOYSA-N |