1-{[(5-methylfuran-2-yl)methyl](2-methylpropyl)amino}-3-(2-methylpropoxy)propan-2-ol
Chemical Structure Depiction of
1-{[(5-methylfuran-2-yl)methyl](2-methylpropyl)amino}-3-(2-methylpropoxy)propan-2-ol
1-{[(5-methylfuran-2-yl)methyl](2-methylpropyl)amino}-3-(2-methylpropoxy)propan-2-ol
Compound characteristics
| Compound ID: | V030-6805 |
| Compound Name: | 1-{[(5-methylfuran-2-yl)methyl](2-methylpropyl)amino}-3-(2-methylpropoxy)propan-2-ol |
| Molecular Weight: | 297.44 |
| Molecular Formula: | C17 H31 N O3 |
| Salt: | not_available |
| Smiles: | CC(C)CN(CC(COCC(C)C)O)Cc1ccc(C)o1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5036 |
| logD: | 2.4745 |
| logSw: | -3.2922 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.538 |
| InChI Key: | HFFDBLOSBPQUQP-UHFFFAOYSA-N |