N-[3-({4-(3,4-dimethylanilino)-1-[(furan-2-yl)methyl]-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl}sulfanyl)phenyl]-3-methoxybenzamide
Chemical Structure Depiction of
N-[3-({4-(3,4-dimethylanilino)-1-[(furan-2-yl)methyl]-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl}sulfanyl)phenyl]-3-methoxybenzamide
N-[3-({4-(3,4-dimethylanilino)-1-[(furan-2-yl)methyl]-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl}sulfanyl)phenyl]-3-methoxybenzamide
Compound characteristics
| Compound ID: | V030-6932 |
| Compound Name: | N-[3-({4-(3,4-dimethylanilino)-1-[(furan-2-yl)methyl]-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl}sulfanyl)phenyl]-3-methoxybenzamide |
| Molecular Weight: | 553.64 |
| Molecular Formula: | C31 H27 N3 O5 S |
| Salt: | not_available |
| Smiles: | Cc1ccc(cc1C)NC1=C(C(N(Cc2ccco2)C1=O)=O)Sc1cccc(c1)NC(c1cccc(c1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 5.9103 |
| logD: | 5.9101 |
| logSw: | -5.4745 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 76.987 |
| InChI Key: | AYRITUFDNJEHJJ-UHFFFAOYSA-N |