4-[(3-methoxyphenyl)methyl]-2-(4-methylphenyl)-3,5-dioxo-N-(1-phenylethyl)-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide
Chemical Structure Depiction of
4-[(3-methoxyphenyl)methyl]-2-(4-methylphenyl)-3,5-dioxo-N-(1-phenylethyl)-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide
4-[(3-methoxyphenyl)methyl]-2-(4-methylphenyl)-3,5-dioxo-N-(1-phenylethyl)-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide
Compound characteristics
| Compound ID: | V030-7684 |
| Compound Name: | 4-[(3-methoxyphenyl)methyl]-2-(4-methylphenyl)-3,5-dioxo-N-(1-phenylethyl)-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxamide |
| Molecular Weight: | 470.53 |
| Molecular Formula: | C27 H26 N4 O4 |
| Salt: | not_available |
| Smiles: | CC(c1ccccc1)NC(C1C(N(Cc2cccc(c2)OC)C(N(c2ccc(C)cc2)N=1)=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5749 |
| logD: | 4.5598 |
| logSw: | -4.3683 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.365 |
| InChI Key: | MPCDRQVGNSHZFI-IBGZPJMESA-N |