N-{[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N'-(2-methoxyphenyl)-N-{[4-(trifluoromethyl)phenyl]methyl}urea
Chemical Structure Depiction of
N-{[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N'-(2-methoxyphenyl)-N-{[4-(trifluoromethyl)phenyl]methyl}urea
N-{[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N'-(2-methoxyphenyl)-N-{[4-(trifluoromethyl)phenyl]methyl}urea
Compound characteristics
| Compound ID: | V030-8539 |
| Compound Name: | N-{[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N'-(2-methoxyphenyl)-N-{[4-(trifluoromethyl)phenyl]methyl}urea |
| Molecular Weight: | 501.48 |
| Molecular Formula: | C26 H23 F4 N3 O3 |
| Salt: | not_available |
| Smiles: | COc1ccccc1NC(N(CC1CC(c2ccc(cc2)F)=NO1)Cc1ccc(cc1)C(F)(F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.9201 |
| logD: | 5.9201 |
| logSw: | -5.7398 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.767 |
| InChI Key: | WRGDVRNXOJIHBD-NRFANRHFSA-N |