N-cyclopentyl-1-ethyl-5-(furan-2-yl)-1H-pyrazole-3-carboxamide
Chemical Structure Depiction of
N-cyclopentyl-1-ethyl-5-(furan-2-yl)-1H-pyrazole-3-carboxamide
N-cyclopentyl-1-ethyl-5-(furan-2-yl)-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | V030-9275 |
| Compound Name: | N-cyclopentyl-1-ethyl-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
| Molecular Weight: | 273.33 |
| Molecular Formula: | C15 H19 N3 O2 |
| Smiles: | CCn1c(cc(C(NC2CCCC2)=O)n1)c1ccco1 |
| Stereo: | ACHIRAL |
| logP: | 2.4237 |
| logD: | 2.4237 |
| logSw: | -2.7605 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.005 |
| InChI Key: | UHCBUVAZZOGLHO-UHFFFAOYSA-N |