2-{4-[(2-chlorophenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-ylidene}-N-cyclopropylacetamide
Chemical Structure Depiction of
2-{4-[(2-chlorophenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-ylidene}-N-cyclopropylacetamide
2-{4-[(2-chlorophenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-ylidene}-N-cyclopropylacetamide
Compound characteristics
| Compound ID: | V030-9584 |
| Compound Name: | 2-{4-[(2-chlorophenyl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-ylidene}-N-cyclopropylacetamide |
| Molecular Weight: | 384.88 |
| Molecular Formula: | C20 H17 Cl N2 O2 S |
| Smiles: | C1CC1NC(\C=C1/C(N(Cc2ccccc2[Cl])c2ccccc2S1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2313 |
| logD: | 4.2313 |
| logSw: | -4.318 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.597 |
| InChI Key: | GTJLWSGKTMUBSC-WOJGMQOQSA-N |