1-{[(3,5-dimethoxyphenyl)methyl](propan-2-yl)amino}-3-(2-methylphenoxy)propan-2-ol
Chemical Structure Depiction of
1-{[(3,5-dimethoxyphenyl)methyl](propan-2-yl)amino}-3-(2-methylphenoxy)propan-2-ol
1-{[(3,5-dimethoxyphenyl)methyl](propan-2-yl)amino}-3-(2-methylphenoxy)propan-2-ol
Compound characteristics
| Compound ID: | V031-0002 |
| Compound Name: | 1-{[(3,5-dimethoxyphenyl)methyl](propan-2-yl)amino}-3-(2-methylphenoxy)propan-2-ol |
| Molecular Weight: | 373.49 |
| Molecular Formula: | C22 H31 N O4 |
| Salt: | not_available |
| Smiles: | CC(C)N(CC(COc1ccccc1C)O)Cc1cc(cc(c1)OC)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5572 |
| logD: | 0.9638 |
| logSw: | -4.4281 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.879 |
| InChI Key: | ABXJKTVDEMNCSZ-IBGZPJMESA-N |