1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-(4-phenyl-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)propan-1-one
Chemical Structure Depiction of
1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-(4-phenyl-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)propan-1-one
1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-(4-phenyl-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)propan-1-one
Compound characteristics
| Compound ID: | V031-0022 |
| Compound Name: | 1-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-3-(4-phenyl-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)propan-1-one |
| Molecular Weight: | 528.5 |
| Molecular Formula: | C27 H27 Cl2 N3 O2 S |
| Salt: | not_available |
| Smiles: | C(CN1CCc2c(ccs2)C1c1ccccc1)C(N1CCN(CC1)C(c1ccc(cc1[Cl])[Cl])=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7972 |
| logD: | 4.2195 |
| logSw: | -5.1014 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.957 |
| InChI Key: | LAKSICSFVMZEAB-AREMUKBSSA-N |