[5-(2,4-difluorophenyl)pyridin-3-yl](morpholin-4-yl)methanone
Chemical Structure Depiction of
[5-(2,4-difluorophenyl)pyridin-3-yl](morpholin-4-yl)methanone
[5-(2,4-difluorophenyl)pyridin-3-yl](morpholin-4-yl)methanone
Compound characteristics
| Compound ID: | V031-0604 |
| Compound Name: | [5-(2,4-difluorophenyl)pyridin-3-yl](morpholin-4-yl)methanone |
| Molecular Weight: | 304.29 |
| Molecular Formula: | C16 H14 F2 N2 O2 |
| Smiles: | C1COCCN1C(c1cc(cnc1)c1ccc(cc1F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8354 |
| logD: | 1.8353 |
| logSw: | -2.1201 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 34.131 |
| InChI Key: | WEUZFKHRUXFYOS-UHFFFAOYSA-N |