3-{5-(4-methoxyphenyl)-1-[4-(methylsulfanyl)phenyl]-1H-pyrrol-2-yl}-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide
Chemical Structure Depiction of
3-{5-(4-methoxyphenyl)-1-[4-(methylsulfanyl)phenyl]-1H-pyrrol-2-yl}-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide
3-{5-(4-methoxyphenyl)-1-[4-(methylsulfanyl)phenyl]-1H-pyrrol-2-yl}-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide
Compound characteristics
| Compound ID: | V031-0788 |
| Compound Name: | 3-{5-(4-methoxyphenyl)-1-[4-(methylsulfanyl)phenyl]-1H-pyrrol-2-yl}-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide |
| Molecular Weight: | 496.67 |
| Molecular Formula: | C31 H32 N2 O2 S |
| Salt: | not_available |
| Smiles: | COc1ccc(cc1)c1ccc(CCC(NC2CCCc3ccccc23)=O)n1c1ccc(cc1)SC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 7.2734 |
| logD: | 7.2734 |
| logSw: | -5.8106 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.983 |
| InChI Key: | UFBVLCUZKWQRPR-LJAQVGFWSA-N |