N-{[5-(2,5-dimethylphenyl)-1,2-oxazol-3-yl]methyl}-4-fluoro-N-(propan-2-yl)benzamide
Chemical Structure Depiction of
N-{[5-(2,5-dimethylphenyl)-1,2-oxazol-3-yl]methyl}-4-fluoro-N-(propan-2-yl)benzamide
N-{[5-(2,5-dimethylphenyl)-1,2-oxazol-3-yl]methyl}-4-fluoro-N-(propan-2-yl)benzamide
Compound characteristics
| Compound ID: | V031-2234 |
| Compound Name: | N-{[5-(2,5-dimethylphenyl)-1,2-oxazol-3-yl]methyl}-4-fluoro-N-(propan-2-yl)benzamide |
| Molecular Weight: | 366.43 |
| Molecular Formula: | C22 H23 F N2 O2 |
| Salt: | not_available |
| Smiles: | CC(C)N(Cc1cc(c2cc(C)ccc2C)on1)C(c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1717 |
| logD: | 5.1717 |
| logSw: | -4.9271 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.224 |
| InChI Key: | XVOJLJOWKKBIPN-UHFFFAOYSA-N |