3-bromo-N-butyl-N-(2-{[(4-tert-butylphenyl)methyl][2-(1H-indol-3-yl)ethyl]amino}-2-oxoethyl)benzamide
Chemical Structure Depiction of
3-bromo-N-butyl-N-(2-{[(4-tert-butylphenyl)methyl][2-(1H-indol-3-yl)ethyl]amino}-2-oxoethyl)benzamide
3-bromo-N-butyl-N-(2-{[(4-tert-butylphenyl)methyl][2-(1H-indol-3-yl)ethyl]amino}-2-oxoethyl)benzamide
Compound characteristics
| Compound ID: | V031-2884 |
| Compound Name: | 3-bromo-N-butyl-N-(2-{[(4-tert-butylphenyl)methyl][2-(1H-indol-3-yl)ethyl]amino}-2-oxoethyl)benzamide |
| Molecular Weight: | 602.62 |
| Molecular Formula: | C34 H40 Br N3 O2 |
| Salt: | not_available |
| Smiles: | CCCCN(CC(N(CCc1c[nH]c2ccccc12)Cc1ccc(cc1)C(C)(C)C)=O)C(c1cccc(c1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 7.6747 |
| logD: | 7.6747 |
| logSw: | -5.8663 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.961 |
| InChI Key: | KGCRWWQKKZZCKT-UHFFFAOYSA-N |