propan-2-yl 2-{[(3-tert-butoxy-2-hydroxypropyl)(ethyl)amino]methyl}-5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxylate
Chemical Structure Depiction of
propan-2-yl 2-{[(3-tert-butoxy-2-hydroxypropyl)(ethyl)amino]methyl}-5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxylate
propan-2-yl 2-{[(3-tert-butoxy-2-hydroxypropyl)(ethyl)amino]methyl}-5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxylate
Compound characteristics
| Compound ID: | V031-3120 |
| Compound Name: | propan-2-yl 2-{[(3-tert-butoxy-2-hydroxypropyl)(ethyl)amino]methyl}-5-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidine-6-carboxylate |
| Molecular Weight: | 439.57 |
| Molecular Formula: | C21 H33 N3 O5 S |
| Salt: | not_available |
| Smiles: | CCN(CC(COC(C)(C)C)O)CC1NC(c2c(C)c(C(=O)OC(C)C)sc2N=1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9448 |
| logD: | 2.9435 |
| logSw: | -3.0449 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 82.547 |
| InChI Key: | QFCSQPTXOXWZDS-AWEZNQCLSA-N |