N-(5,7-dichloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-methoxypropanamide
Chemical Structure Depiction of
N-(5,7-dichloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-methoxypropanamide
N-(5,7-dichloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-methoxypropanamide
Compound characteristics
| Compound ID: | V031-3570 |
| Compound Name: | N-(5,7-dichloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-methoxypropanamide |
| Molecular Weight: | 341.24 |
| Molecular Formula: | C16 H18 Cl2 N2 O2 |
| Salt: | not_available |
| Smiles: | COCCC(NC1CCc2c(C1)c1c(cc(cc1[nH]2)[Cl])[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2165 |
| logD: | 3.2165 |
| logSw: | -3.533 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 43.356 |
| InChI Key: | IKQLJATZNVLNGO-SNVBAGLBSA-N |