N-(3,4-dimethylphenyl)-5-[(4-methylbenzene-1-sulfonyl)amino]-1H-1,2,3-triazole-4-carboxamide
					Chemical Structure Depiction of
N-(3,4-dimethylphenyl)-5-[(4-methylbenzene-1-sulfonyl)amino]-1H-1,2,3-triazole-4-carboxamide
			N-(3,4-dimethylphenyl)-5-[(4-methylbenzene-1-sulfonyl)amino]-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | Y010-0433 | 
| Compound Name: | N-(3,4-dimethylphenyl)-5-[(4-methylbenzene-1-sulfonyl)amino]-1H-1,2,3-triazole-4-carboxamide | 
| Molecular Weight: | 385.44 | 
| Molecular Formula: | C18 H19 N5 O3 S | 
| Smiles: | Cc1ccc(cc1)S(Nc1c(C(Nc2ccc(C)c(C)c2)=O)nn[nH]1)(=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 3.2413 | 
| logD: | 1.0921 | 
| logSw: | -3.4871 | 
| Hydrogen bond acceptors count: | 8 | 
| Hydrogen bond donors count: | 3 | 
| Polar surface area: | 101.292 | 
| InChI Key: | WITFFIFLNAEJMI-UHFFFAOYSA-N | 
 
				 
				