2-[2-(1H-indol-3-yl)acetamido]-N-(2-methylphenyl)-2-phenylacetamide
Chemical Structure Depiction of
2-[2-(1H-indol-3-yl)acetamido]-N-(2-methylphenyl)-2-phenylacetamide
2-[2-(1H-indol-3-yl)acetamido]-N-(2-methylphenyl)-2-phenylacetamide
Compound characteristics
| Compound ID: | Y010-0627 |
| Compound Name: | 2-[2-(1H-indol-3-yl)acetamido]-N-(2-methylphenyl)-2-phenylacetamide |
| Molecular Weight: | 397.48 |
| Molecular Formula: | C25 H23 N3 O2 |
| Smiles: | [H]C(C(Nc1ccccc1C)=O)(c1ccccc1)NC(Cc1c[nH]c2ccccc12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7807 |
| logD: | 3.7805 |
| logSw: | -4.0338 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 56.055 |
| InChI Key: | IRSMNUBGVQEENB-XMMPIXPASA-N |