3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-phenylquinazolin-4(3H)-one
Chemical Structure Depiction of
3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-phenylquinazolin-4(3H)-one
3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-phenylquinazolin-4(3H)-one
Compound characteristics
| Compound ID: | Y010-1155 |
| Compound Name: | 3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-phenylquinazolin-4(3H)-one |
| Molecular Weight: | 383.42 |
| Molecular Formula: | C24 H18 F N3 O |
| Smiles: | C(CN1C(c2ccccc2)=Nc2ccccc2C1=O)c1c[nH]c2ccc(cc12)F |
| Stereo: | ACHIRAL |
| logP: | 4.3027 |
| logD: | 4.3011 |
| logSw: | -4.2814 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.199 |
| InChI Key: | UYRKKUKUBQAJAF-UHFFFAOYSA-N |