N-(5-{[(2,4-dichlorophenyl)methyl]sulfanyl}-1,3,4-thiadiazol-2-yl)naphthalene-1-carboxamide
Chemical Structure Depiction of
N-(5-{[(2,4-dichlorophenyl)methyl]sulfanyl}-1,3,4-thiadiazol-2-yl)naphthalene-1-carboxamide
N-(5-{[(2,4-dichlorophenyl)methyl]sulfanyl}-1,3,4-thiadiazol-2-yl)naphthalene-1-carboxamide
Compound characteristics
| Compound ID: | Y010-1762 |
| Compound Name: | N-(5-{[(2,4-dichlorophenyl)methyl]sulfanyl}-1,3,4-thiadiazol-2-yl)naphthalene-1-carboxamide |
| Molecular Weight: | 446.38 |
| Molecular Formula: | C20 H13 Cl2 N3 O S2 |
| Smiles: | C(c1ccc(cc1[Cl])[Cl])Sc1nnc(NC(c2cccc3ccccc23)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 6.8496 |
| logD: | 6.8495 |
| logSw: | -6.6518 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.693 |
| InChI Key: | YAYXGAVHGHMTDA-UHFFFAOYSA-N |