6-chloro-N~2~,N~4~-diphenyl-1,3,5-triazine-2,4-diamine
Chemical Structure Depiction of
6-chloro-N~2~,N~4~-diphenyl-1,3,5-triazine-2,4-diamine
6-chloro-N~2~,N~4~-diphenyl-1,3,5-triazine-2,4-diamine
Compound characteristics
| Compound ID: | Y020-0079 |
| Compound Name: | 6-chloro-N~2~,N~4~-diphenyl-1,3,5-triazine-2,4-diamine |
| Molecular Weight: | 297.74 |
| Molecular Formula: | C15 H12 Cl N5 |
| Smiles: | c1ccc(cc1)Nc1nc(Nc2ccccc2)nc(n1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.6963 |
| logD: | 4.6963 |
| logSw: | -4.9295 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 49.932 |
| InChI Key: | AHBSUJXKRKWNBN-UHFFFAOYSA-N |