1-(2-chlorophenyl)-3-[4-(diphenylmethyl)piperazin-1-yl]pyrrolidine-2,5-dione
Chemical Structure Depiction of
1-(2-chlorophenyl)-3-[4-(diphenylmethyl)piperazin-1-yl]pyrrolidine-2,5-dione
1-(2-chlorophenyl)-3-[4-(diphenylmethyl)piperazin-1-yl]pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | Y020-0429 |
| Compound Name: | 1-(2-chlorophenyl)-3-[4-(diphenylmethyl)piperazin-1-yl]pyrrolidine-2,5-dione |
| Molecular Weight: | 459.98 |
| Molecular Formula: | C27 H26 Cl N3 O2 |
| Smiles: | C1C(C(N(C1=O)c1ccccc1[Cl])=O)N1CCN(CC1)C(c1ccccc1)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9624 |
| logD: | 3.9584 |
| logSw: | -4.2793 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 34.248 |
| InChI Key: | BTUOPULVRLMQFF-XMMPIXPASA-N |