N~2~-(2-ethoxyphenyl)-6-{[4-(4-methoxyphenyl)piperazin-1-yl]methyl}-1,3,5-triazine-2,4-diamine
Chemical Structure Depiction of
N~2~-(2-ethoxyphenyl)-6-{[4-(4-methoxyphenyl)piperazin-1-yl]methyl}-1,3,5-triazine-2,4-diamine
N~2~-(2-ethoxyphenyl)-6-{[4-(4-methoxyphenyl)piperazin-1-yl]methyl}-1,3,5-triazine-2,4-diamine
Compound characteristics
| Compound ID: | Y020-0728 |
| Compound Name: | N~2~-(2-ethoxyphenyl)-6-{[4-(4-methoxyphenyl)piperazin-1-yl]methyl}-1,3,5-triazine-2,4-diamine |
| Molecular Weight: | 435.53 |
| Molecular Formula: | C23 H29 N7 O2 |
| Smiles: | CCOc1ccccc1Nc1nc(CN2CCN(CC2)c2ccc(cc2)OC)nc(N)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.7099 |
| logD: | 3.6622 |
| logSw: | -4.0424 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 82.657 |
| InChI Key: | VEGPXVOOSAJTSE-UHFFFAOYSA-N |