3-{[2-(1H-indol-3-yl)ethyl]amino}-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione
Chemical Structure Depiction of
3-{[2-(1H-indol-3-yl)ethyl]amino}-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione
3-{[2-(1H-indol-3-yl)ethyl]amino}-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | Y020-1888 |
| Compound Name: | 3-{[2-(1H-indol-3-yl)ethyl]amino}-1-(4-phenoxyphenyl)pyrrolidine-2,5-dione |
| Molecular Weight: | 425.49 |
| Molecular Formula: | C26 H23 N3 O3 |
| Smiles: | C(CNC1CC(N(C1=O)c1ccc(cc1)Oc1ccccc1)=O)c1c[nH]c2ccccc12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2486 |
| logD: | 3.2483 |
| logSw: | -3.3437 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.369 |
| InChI Key: | PHXANQWWTGSHOR-DEOSSOPVSA-N |